C8H5FN2OS — CID 144584123
3-fluorothieno[2,3-c]pyridine-2-carboxamide (PubChem CID 144584123) has the molecular formula C8H5FN2OS and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-fluorothieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 3-fluorothieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 144584123 |
| Molecular Formula | C8H5FN2OS |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 3-fluorothieno[2,3-c]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2cnccc2c1F |
| InChI | InChI=1S/C8H5FN2OS/c9-6-4-1-2-11-3-5(4)13-7(6)8(10)12/h1-3H,(H2,10,12) |
| InChIKey | GMQKAIZLWVOMOL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |