1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid

C7H10O4S2 — CID 14458448

IUPAC1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid
SMILESO=C(O)C1SCSCC12OCCO2
InChIInChI=1S/C7H10O4S2/c8-6(9)5-7(3-12-4-13-5)10-1-2-11-7/h5H,1-4H2,(H,8,9)
InChIKeyWTXUITCFHWNCBS-UHFFFAOYSA-N
MW222.29 g/mol
LogP0.62
Rot. Bonds1

About 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid

1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid (PubChem CID 14458448) has the molecular formula C7H10O4S2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid.

Molecular Properties

Compound Name1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid
PubChem CID14458448
Molecular FormulaC7H10O4S2
Molecular Weight222.29 g/mol
Exact Mass222.00
IUPAC Name1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid
SMILESO=C(O)C1SCSCC12OCCO2
InChIInChI=1S/C7H10O4S2/c8-6(9)5-7(3-12-4-13-5)10-1-2-11-7/h5H,1-4H2,(H,8,9)
InChIKeyWTXUITCFHWNCBS-UHFFFAOYSA-N
XLogP0.62
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.29
LogP ≤ 50.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid?
The IUPAC name of 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid (CID 14458448) is 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid.
What is the SMILES notation for 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid?
The canonical SMILES for 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid is O=C(O)C1SCSCC12OCCO2.
What is the InChIKey of 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid?
The InChIKey is WTXUITCFHWNCBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4S2/c8-6(9)5-7(3-12-4-13-5)10-1-2-11-7/h5H,1-4H2,(H,8,9).
What are the key properties of 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid?
1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid has a molecular weight of 222.29 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxa-7,9-dithiaspiro[4.5]decane-6-carboxylic acid is sourced from PubChem (CID 14458448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).