C7H12O3S2 — CID 134104729
1,4-dioxa-7,9-dithiaspiro[4.5]decan-6-ylmethanol (PubChem CID 134104729) has the molecular formula C7H12O3S2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1,4-dioxa-7,9-dithiaspiro[4.5]decan-6-ylmethanol.
| Compound Name | 1,4-dioxa-7,9-dithiaspiro[4.5]decan-6-ylmethanol |
|---|---|
| PubChem CID | 134104729 |
| Molecular Formula | C7H12O3S2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 1,4-dioxa-7,9-dithiaspiro[4.5]decan-6-ylmethanol |
| SMILES | OCC1SCSCC12OCCO2 |
| InChI | InChI=1S/C7H12O3S2/c8-3-6-7(4-11-5-12-6)9-1-2-10-7/h6,8H,1-5H2 |
| InChIKey | HQAQKJGBCLXQPP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |