C5H8F2OS — CID 78063983
(3,3-difluorothiolan-2-yl)methanol (PubChem CID 78063983) has the molecular formula C5H8F2OS and a molecular weight of 154.18 g/mol. Its IUPAC name is (3,3-difluorothiolan-2-yl)methanol.
| Compound Name | (3,3-difluorothiolan-2-yl)methanol |
|---|---|
| PubChem CID | 78063983 |
| Molecular Formula | C5H8F2OS |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | (3,3-difluorothiolan-2-yl)methanol |
| SMILES | OCC1SCCC1(F)F |
| InChI | InChI=1S/C5H8F2OS/c6-5(7)1-2-9-4(5)3-8/h4,8H,1-3H2 |
| InChIKey | FCVNRFJEJUXTHQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |