About [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate
[6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate (PubChem CID 144584781) has the molecular formula C13H23ClN2O3
and a molecular weight of 290.79 g/mol. Its IUPAC name is [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate.
Molecular Properties
| Compound Name | [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate |
| PubChem CID | 144584781 |
| Molecular Formula | C13H23ClN2O3 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate |
| SMILES | CC.CC(Cc1ccc(CO)cn1)NCl.COC=O |
| InChI | InChI=1S/C9H13ClN2O.C2H4O2.C2H6/c1-7(12-10)4-9-3-2-8(6-13)5-11-9;1-4-2-3;1-2/h2-3,5,7,12-13H,4,6H2,1H3;2H,1H3;1-2H3 |
| InChIKey | CFNPVLXILLPDNR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate?
The IUPAC name of [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate (CID 144584781) is [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate.
What is the SMILES notation for [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate?
The canonical SMILES for [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate is CC.CC(Cc1ccc(CO)cn1)NCl.COC=O.
What is the InChIKey of [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate?
The InChIKey is CFNPVLXILLPDNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2O.C2H4O2.C2H6/c1-7(12-10)4-9-3-2-8(6-13)5-11-9;1-4-2-3;1-2/h2-3,5,7,12-13H,4,6H2,1H3;2H,1H3;1-2H3.
What are the key properties of [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate?
[6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate has a molecular weight of 290.79 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[2-(chloroamino)propyl]-3-pyridinyl]methanol;ethane;methyl formate is sourced from PubChem (CID 144584781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).