C10H12Br2O2 — CID 174958128
1,4-bis(bromomethyl)benzene;methyl formate (PubChem CID 174958128) has the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)benzene;methyl formate.
| Compound Name | 1,4-bis(bromomethyl)benzene;methyl formate |
|---|---|
| PubChem CID | 174958128 |
| Molecular Formula | C10H12Br2O2 |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | 1,4-bis(bromomethyl)benzene;methyl formate |
| SMILES | BrCc1ccc(CBr)cc1.COC=O |
| InChI | InChI=1S/C8H8Br2.C2H4O2/c9-5-7-1-2-8(6-10)4-3-7;1-4-2-3/h1-4H,5-6H2;2H,1H3 |
| InChIKey | RTXQOSTVCAUYTB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|