1,4-bis(bromomethyl)benzene;methyl formate

C10H12Br2O2 — CID 174958128

IUPAC1,4-bis(bromomethyl)benzene;methyl formate
SMILESBrCc1ccc(CBr)cc1.COC=O
InChIInChI=1S/C8H8Br2.C2H4O2/c9-5-7-1-2-8(6-10)4-3-7;1-4-2-3/h1-4H,5-6H2;2H,1H3
InChIKeyRTXQOSTVCAUYTB-UHFFFAOYSA-N
MW324.01 g/mol
LogP3.27
Rot. Bonds3

About 1,4-bis(bromomethyl)benzene;methyl formate

1,4-bis(bromomethyl)benzene;methyl formate (PubChem CID 174958128) has the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)benzene;methyl formate.

Molecular Properties

Compound Name1,4-bis(bromomethyl)benzene;methyl formate
PubChem CID174958128
Molecular FormulaC10H12Br2O2
Molecular Weight324.01 g/mol
Exact Mass321.92
IUPAC Name1,4-bis(bromomethyl)benzene;methyl formate
SMILESBrCc1ccc(CBr)cc1.COC=O
InChIInChI=1S/C8H8Br2.C2H4O2/c9-5-7-1-2-8(6-10)4-3-7;1-4-2-3/h1-4H,5-6H2;2H,1H3
InChIKeyRTXQOSTVCAUYTB-UHFFFAOYSA-N
XLogP3.27
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.01
LogP ≤ 53.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 1,4-bis(bromomethyl)benzene;methyl formate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-bis(bromomethyl)benzene;methyl formate?
The IUPAC name of 1,4-bis(bromomethyl)benzene;methyl formate (CID 174958128) is 1,4-bis(bromomethyl)benzene;methyl formate.
What is the SMILES notation for 1,4-bis(bromomethyl)benzene;methyl formate?
The canonical SMILES for 1,4-bis(bromomethyl)benzene;methyl formate is BrCc1ccc(CBr)cc1.COC=O.
What is the InChIKey of 1,4-bis(bromomethyl)benzene;methyl formate?
The InChIKey is RTXQOSTVCAUYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2.C2H4O2/c9-5-7-1-2-8(6-10)4-3-7;1-4-2-3/h1-4H,5-6H2;2H,1H3.
What are the key properties of 1,4-bis(bromomethyl)benzene;methyl formate?
1,4-bis(bromomethyl)benzene;methyl formate has a molecular weight of 324.01 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(bromomethyl)benzene;methyl formate is sourced from PubChem (CID 174958128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).