C26H49N4O9P — CID 144585316
2-[[2-[bis(carboxymethyl)amino]-7-(dibutylamino)-7-oxoheptyl]-[2-[carboxymethyl(phosphanylmethyl)amino]ethyl]amino]acetic acid (PubChem CID 144585316) has the molecular formula C26H49N4O9P and a molecular weight of 592.67 g/mol. Its IUPAC name is 2-[[2-[bis(carboxymethyl)amino]-7-(dibutylamino)-7-oxoheptyl]-[2-[carboxymethyl(phosphanylmethyl)amino]ethyl]amino]acetic acid.
| Compound Name | 2-[[2-[bis(carboxymethyl)amino]-7-(dibutylamino)-7-oxoheptyl]-[2-[carboxymethyl(phosphanylmethyl)amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 144585316 |
| Molecular Formula | C26H49N4O9P |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]-7-(dibutylamino)-7-oxoheptyl]-[2-[carboxymethyl(phosphanylmethyl)amino]ethyl]amino]acetic acid |
| SMILES | CCCCN(CCCC)C(=O)CCCCC(CN(CCN(CP)CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C26H49N4O9P/c1-3-5-11-29(12-6-4-2)22(31)10-8-7-9-21(30(18-25(36)37)19-26(38)39)15-27(16-23(32)33)13-14-28(20-40)17-24(34)35/h21H,3-20,40H2,1-2H3,(H,32,33)(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | VDPPXZVJDURZEF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 179.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|