C28H38N4O3S — CID 144585398
(1S,7R)-4-[[(2R)-2-[[2-[1,2-benzothiazol-3-yl(ethyl)amino]ethyl-hydroxyamino]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 144585398) has the molecular formula C28H38N4O3S and a molecular weight of 510.70 g/mol. Its IUPAC name is (1S,7R)-4-[[(2R)-2-[[2-[1,2-benzothiazol-3-yl(ethyl)amino]ethyl-hydroxyamino]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,7R)-4-[[(2R)-2-[[2-[1,2-benzothiazol-3-yl(ethyl)amino]ethyl-hydroxyamino]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 144585398 |
| Molecular Formula | C28H38N4O3S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | (1S,7R)-4-[[(2R)-2-[[2-[1,2-benzothiazol-3-yl(ethyl)amino]ethyl-hydroxyamino]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCN(CCN(O)C[C@@H]1CCCCC1CN1C(=O)C2C(C1=O)[C@H]1CC[C@@H]2C1)c1nsc2ccccc12 |
| InChI | InChI=1S/C28H38N4O3S/c1-2-30(26-22-9-5-6-10-23(22)36-29-26)13-14-31(35)16-20-7-3-4-8-21(20)17-32-27(33)24-18-11-12-19(15-18)25(24)28(32)34/h5-6,9-10,18-21,24-25,35H,2-4,7-8,11-17H2,1H3/t18-,19+,20-,21?,24?,25?/m0/s1 |
| InChIKey | JCFUPCTZQJBEKI-LQDROSRISA-N |
| XLogP | 4.65 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|