C26H43N3O3S — CID 144587098
1-[4-(1-ethylpiperidin-4-yl)piperidin-1-yl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfanyl-methylamino]ethoxy]ethanone (PubChem CID 144587098) has the molecular formula C26H43N3O3S and a molecular weight of 477.72 g/mol. Its IUPAC name is 1-[4-(1-ethylpiperidin-4-yl)piperidin-1-yl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfanyl-methylamino]ethoxy]ethanone.
| Compound Name | 1-[4-(1-ethylpiperidin-4-yl)piperidin-1-yl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfanyl-methylamino]ethoxy]ethanone |
|---|---|
| PubChem CID | 144587098 |
| Molecular Formula | C26H43N3O3S |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 1-[4-(1-ethylpiperidin-4-yl)piperidin-1-yl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfanyl-methylamino]ethoxy]ethanone |
| SMILES | CCN1CCC(C2CCN(C(=O)COCCN(C)Sc3c(C)cc(OC)cc3C)CC2)CC1 |
| InChI | InChI=1S/C26H43N3O3S/c1-6-28-11-7-22(8-12-28)23-9-13-29(14-10-23)25(30)19-32-16-15-27(4)33-26-20(2)17-24(31-5)18-21(26)3/h17-18,22-23H,6-16,19H2,1-5H3 |
| InChIKey | UJXVGOUNFCKOGA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|