C39H46O10+2 — CID 144588977
[1-[[2,7-bis(2-hydroxy-3-prop-2-enoxypropoxy)naphthalen-1-yl]methyl]-7-(oxiran-1-ium-2-ylmethoxy)naphthalen-2-yl]-(oxiran-2-ylmethyl)oxidanium (PubChem CID 144588977) has the molecular formula C39H46O10+2 and a molecular weight of 674.79 g/mol. Its IUPAC name is [1-[[2,7-bis(2-hydroxy-3-prop-2-enoxypropoxy)naphthalen-1-yl]methyl]-7-(oxiran-1-ium-2-ylmethoxy)naphthalen-2-yl]-(oxiran-2-ylmethyl)oxidanium.
| Compound Name | [1-[[2,7-bis(2-hydroxy-3-prop-2-enoxypropoxy)naphthalen-1-yl]methyl]-7-(oxiran-1-ium-2-ylmethoxy)naphthalen-2-yl]-(oxiran-2-ylmethyl)oxidanium |
|---|---|
| PubChem CID | 144588977 |
| Molecular Formula | C39H46O10+2 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | [1-[[2,7-bis(2-hydroxy-3-prop-2-enoxypropoxy)naphthalen-1-yl]methyl]-7-(oxiran-1-ium-2-ylmethoxy)naphthalen-2-yl]-(oxiran-2-ylmethyl)oxidanium |
| SMILES | C=CCOCC(O)COc1ccc2ccc(OCC(O)COCC=C)c(Cc3c([OH+]CC4CO4)ccc4ccc(OCC5C[OH+]5)cc34)c2c1 |
| InChI | InChI=1S/C39H44O10/c1-3-13-42-18-28(40)20-44-30-9-5-26-7-11-38(48-21-29(41)19-43-14-4-2)36(34(26)15-30)17-37-35-16-31(45-22-32-23-46-32)10-6-27(35)8-12-39(37)49-25-33-24-47-33/h3-12,15-16,28-29,32-33,40-41H,1-2,13-14,17-25H2/p+2 |
| InChIKey | SYXJVRMSKUFFOQ-UHFFFAOYSA-P |
| XLogP | 4.40 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|