C17H19F3O3S — CID 144594148
(7-prop-1-en-2-ylspiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl) trifluoromethanesulfonate (PubChem CID 144594148) has the molecular formula C17H19F3O3S and a molecular weight of 360.40 g/mol. Its IUPAC name is (7-prop-1-en-2-ylspiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl) trifluoromethanesulfonate.
| Compound Name | (7-prop-1-en-2-ylspiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 144594148 |
| Molecular Formula | C17H19F3O3S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (7-prop-1-en-2-ylspiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl) trifluoromethanesulfonate |
| SMILES | C=C(C)c1ccc(OS(=O)(=O)C(F)(F)F)c2c1CCC21CCCC1 |
| InChI | InChI=1S/C17H19F3O3S/c1-11(2)12-5-6-14(23-24(21,22)17(18,19)20)15-13(12)7-10-16(15)8-3-4-9-16/h5-6H,1,3-4,7-10H2,2H3 |
| InChIKey | CIXOFXWJYRKCMF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|