C22H22O2S2 — CID 144596295
1,2-bis(ethenyl)-3-[[3-ethenyl-2-[(Z)-prop-1-enyl]-6-sulfanyloxyphenyl]methyl]-4-sulfanyloxybenzene (PubChem CID 144596295) has the molecular formula C22H22O2S2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-3-[[3-ethenyl-2-[(Z)-prop-1-enyl]-6-sulfanyloxyphenyl]methyl]-4-sulfanyloxybenzene.
| Compound Name | 1,2-bis(ethenyl)-3-[[3-ethenyl-2-[(Z)-prop-1-enyl]-6-sulfanyloxyphenyl]methyl]-4-sulfanyloxybenzene |
|---|---|
| PubChem CID | 144596295 |
| Molecular Formula | C22H22O2S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1,2-bis(ethenyl)-3-[[3-ethenyl-2-[(Z)-prop-1-enyl]-6-sulfanyloxyphenyl]methyl]-4-sulfanyloxybenzene |
| SMILES | C=Cc1ccc(OS)c(Cc2c(OS)ccc(C=C)c2/C=C\C)c1C=C |
| InChI | InChI=1S/C22H22O2S2/c1-5-9-18-16(7-3)11-13-22(24-26)20(18)14-19-17(8-4)15(6-2)10-12-21(19)23-25/h5-13,25-26H,2-4,14H2,1H3/b9-5- |
| InChIKey | ABRBFJHPNLYTLV-UITAMQMPSA-N |
| XLogP | 6.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|