C11H14N2OS — CID 144596300
[2,3-bis(ethenyl)-6-sulfanyloxyphenyl]methylhydrazine (PubChem CID 144596300) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is [2,3-bis(ethenyl)-6-sulfanyloxyphenyl]methylhydrazine.
| Compound Name | [2,3-bis(ethenyl)-6-sulfanyloxyphenyl]methylhydrazine |
|---|---|
| PubChem CID | 144596300 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | [2,3-bis(ethenyl)-6-sulfanyloxyphenyl]methylhydrazine |
| SMILES | C=Cc1ccc(OS)c(CNN)c1C=C |
| InChI | InChI=1S/C11H14N2OS/c1-3-8-5-6-11(14-15)10(7-13-12)9(8)4-2/h3-6,13,15H,1-2,7,12H2 |
| InChIKey | LAIIPTUGQRMEPB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|