C9H10N2 — CID 144598204
3-methyl-2,3-dihydro-1,5-naphthyridine (PubChem CID 144598204) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-methyl-2,3-dihydro-1,5-naphthyridine.
| Compound Name | 3-methyl-2,3-dihydro-1,5-naphthyridine |
|---|---|
| PubChem CID | 144598204 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 3-methyl-2,3-dihydro-1,5-naphthyridine |
| SMILES | CC1C=c2ncccc2=NC1 |
| InChI | InChI=1S/C9H10N2/c1-7-5-9-8(11-6-7)3-2-4-10-9/h2-5,7H,6H2,1H3 |
| InChIKey | HYDHTDGZLBSVHO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |