C11H18N2O — CID 144599678
2-(cyclohexa-1,5-dien-1-yloxymethyl)piperazine (PubChem CID 144599678) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-dien-1-yloxymethyl)piperazine.
| Compound Name | 2-(cyclohexa-1,5-dien-1-yloxymethyl)piperazine |
|---|---|
| PubChem CID | 144599678 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-(cyclohexa-1,5-dien-1-yloxymethyl)piperazine |
| SMILES | C1=CC(OCC2CNCCN2)=CCC1 |
| InChI | InChI=1S/C11H18N2O/c1-2-4-11(5-3-1)14-9-10-8-12-6-7-13-10/h2,4-5,10,12-13H,1,3,6-9H2 |
| InChIKey | YSAIAUPVUIQXLK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |