C30H45N7 — CID 144599709
(3Z,5E)-6-(5-butan-2-yl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-7-methyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine;ethane (PubChem CID 144599709) has the molecular formula C30H45N7 and a molecular weight of 503.74 g/mol. Its IUPAC name is (3Z,5E)-6-(5-butan-2-yl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-7-methyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine;ethane.
| Compound Name | (3Z,5E)-6-(5-butan-2-yl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-7-methyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine;ethane |
|---|---|
| PubChem CID | 144599709 |
| Molecular Formula | C30H45N7 |
| Molecular Weight | 503.74 g/mol |
| Exact Mass | 503.37 |
| IUPAC Name | (3Z,5E)-6-(5-butan-2-yl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-7-methyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine;ethane |
| SMILES | CC.CCC(C)C1=c2c(N3CCNCC3)nc(/C3=C/C=N\CNC4=C(CCCC4)C3C)nc2=CCN=C1 |
| InChI | InChI=1S/C28H39N7.C2H6/c1-4-19(2)23-17-30-12-10-25-26(23)28(35-15-13-29-14-16-35)34-27(33-25)22-9-11-31-18-32-24-8-6-5-7-21(24)20(22)3;1-2/h9-11,17,19-20,29,32H,4-8,12-16,18H2,1-3H3;1-2H3/b22-9+,31-11-; |
| InChIKey | NHDRXZCKUWBRRQ-VIVHQVLXSA-N |
| XLogP | 3.45 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |