C29H39N7 — CID 144885047
(3Z,5E)-6-(5-cyclobutyl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-2,7-dimethyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine (PubChem CID 144885047) has the molecular formula C29H39N7 and a molecular weight of 485.68 g/mol. Its IUPAC name is (3Z,5E)-6-(5-cyclobutyl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-2,7-dimethyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine.
| Compound Name | (3Z,5E)-6-(5-cyclobutyl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-2,7-dimethyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine |
|---|---|
| PubChem CID | 144885047 |
| Molecular Formula | C29H39N7 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | (3Z,5E)-6-(5-cyclobutyl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-2,7-dimethyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine |
| SMILES | CC1/N=C\C=C(\c2nc(N3CCNCC3)c3c(n2)=CCN=CC=3C2CCC2)C(C)C2=C(CCCC2)N1 |
| InChI | InChI=1S/C29H39N7/c1-19-22-8-3-4-9-25(22)33-20(2)32-13-10-23(19)28-34-26-11-12-31-18-24(21-6-5-7-21)27(26)29(35-28)36-16-14-30-15-17-36/h10-11,13,18-21,30,33H,3-9,12,14-17H2,1-2H3/b23-10+,32-13- |
| InChIKey | JMKMINYRLVLYIA-QCNWHTAESA-N |
| XLogP | 2.57 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |