C28H39N7 — CID 144599710
(3Z,5E)-6-(5-butan-2-yl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-7-methyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine (PubChem CID 144599710) has the molecular formula C28H39N7 and a molecular weight of 473.67 g/mol. Its IUPAC name is (3Z,5E)-6-(5-butan-2-yl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-7-methyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine.
| Compound Name | (3Z,5E)-6-(5-butan-2-yl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-7-methyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine |
|---|---|
| PubChem CID | 144599710 |
| Molecular Formula | C28H39N7 |
| Molecular Weight | 473.67 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | (3Z,5E)-6-(5-butan-2-yl-4-piperazin-1-yl-8H-pyrimido[4,5-d]azepin-2-yl)-7-methyl-2,7,8,9,10,11-hexahydro-1H-1,3-benzodiazonine |
| SMILES | CCC(C)C1=c2c(N3CCNCC3)nc(/C3=C/C=N\CNC4=C(CCCC4)C3C)nc2=CCN=C1 |
| InChI | InChI=1S/C28H39N7/c1-4-19(2)23-17-30-12-10-25-26(23)28(35-15-13-29-14-16-35)34-27(33-25)22-9-11-31-18-32-24-8-6-5-7-21(24)20(22)3/h9-11,17,19-20,29,32H,4-8,12-16,18H2,1-3H3/b22-9+,31-11- |
| InChIKey | DBJXYAGOFQZTQV-POHKXTHRSA-N |
| XLogP | 2.43 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |