C18H18N2O3 — CID 144600131
2-[[[5-[(3E)-hexa-1,3,5-trien-3-yl]furan-2-yl]methylamino]methyl]pyridine-4-carboxylic acid (PubChem CID 144600131) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[[[5-[(3E)-hexa-1,3,5-trien-3-yl]furan-2-yl]methylamino]methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[[[5-[(3E)-hexa-1,3,5-trien-3-yl]furan-2-yl]methylamino]methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 144600131 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[[[5-[(3E)-hexa-1,3,5-trien-3-yl]furan-2-yl]methylamino]methyl]pyridine-4-carboxylic acid |
| SMILES | C=C/C=C(\C=C)c1ccc(CNCc2cc(C(=O)O)ccn2)o1 |
| InChI | InChI=1S/C18H18N2O3/c1-3-5-13(4-2)17-7-6-16(23-17)12-19-11-15-10-14(18(21)22)8-9-20-15/h3-10,19H,1-2,11-12H2,(H,21,22)/b13-5+ |
| InChIKey | KACXHTQYNGZYLJ-WLRTZDKTSA-N |
| XLogP | 3.42 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|