C9H17N — CID 144601769
2,3-dimethyl-1-propyl-2,3-dihydropyrrole (PubChem CID 144601769) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is 2,3-dimethyl-1-propyl-2,3-dihydropyrrole.
| Compound Name | 2,3-dimethyl-1-propyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 144601769 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 2,3-dimethyl-1-propyl-2,3-dihydropyrrole |
| SMILES | CCCN1C=CC(C)C1C |
| InChI | InChI=1S/C9H17N/c1-4-6-10-7-5-8(2)9(10)3/h5,7-9H,4,6H2,1-3H3 |
| InChIKey | FEMQEILPODBBOT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |