C7H13N — CID 22893886
1,2,3-trimethyl-2,3-dihydropyrrole (PubChem CID 22893886) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is 1,2,3-trimethyl-2,3-dihydropyrrole.
| Compound Name | 1,2,3-trimethyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 22893886 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | 1,2,3-trimethyl-2,3-dihydropyrrole |
| SMILES | CC1C=CN(C)C1C |
| InChI | InChI=1S/C7H13N/c1-6-4-5-8(3)7(6)2/h4-7H,1-3H3 |
| InChIKey | ONCZDGIVDLLNKD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |