C6H11N — CID 58811647
(2S,3S)-2,3-dimethyl-2,3-dihydro-1H-pyrrole (PubChem CID 58811647) has the molecular formula C6H11N and a molecular weight of 97.16 g/mol. Its IUPAC name is (2S,3S)-2,3-dimethyl-2,3-dihydro-1H-pyrrole.
| Compound Name | (2S,3S)-2,3-dimethyl-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 58811647 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | (2S,3S)-2,3-dimethyl-2,3-dihydro-1H-pyrrole |
| SMILES | C[C@@H]1NC=C[C@@H]1C |
| InChI | InChI=1S/C6H11N/c1-5-3-4-7-6(5)2/h3-7H,1-2H3/t5-,6-/m0/s1 |
| InChIKey | JWMGQAVBJUCNGH-WDSKDSINSA-N |
| XLogP | 1.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |