About acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine
acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine (PubChem CID 144603069) has the molecular formula C15H26N2O2
and a molecular weight of 266.38 g/mol. Its IUPAC name is acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine.
Molecular Properties
| Compound Name | acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine |
| PubChem CID | 144603069 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine |
| SMILES | C1CCNC1.CC=O.CNC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO.C4H9N.C2H4O/c1-7(10-2)8-3-5-9(11)6-4-8;1-2-4-5-3-1;1-2-3/h3-7,10-11H,1-2H3;5H,1-4H2;2H,1H3 |
| InChIKey | JFOBYNOZMQDCHH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine?
The IUPAC name of acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine (CID 144603069) is acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine.
What is the SMILES notation for acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine?
The canonical SMILES for acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine is C1CCNC1.CC=O.CNC(C)c1ccc(O)cc1.
What is the InChIKey of acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine?
The InChIKey is JFOBYNOZMQDCHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C4H9N.C2H4O/c1-7(10-2)8-3-5-9(11)6-4-8;1-2-4-5-3-1;1-2-3/h3-7,10-11H,1-2H3;5H,1-4H2;2H,1H3.
What are the key properties of acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine?
acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine has a molecular weight of 266.38 g/mol, XLogP of 2.25, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;4-[1-(methylamino)ethyl]phenol;pyrrolidine is sourced from PubChem (CID 144603069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).