C16H28N2O3 — CID 144603083
N-[1-(4-hydroxyphenyl)ethyl]acetamide;methoxymethane;pyrrolidine (PubChem CID 144603083) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[1-(4-hydroxyphenyl)ethyl]acetamide;methoxymethane;pyrrolidine.
| Compound Name | N-[1-(4-hydroxyphenyl)ethyl]acetamide;methoxymethane;pyrrolidine |
|---|---|
| PubChem CID | 144603083 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-[1-(4-hydroxyphenyl)ethyl]acetamide;methoxymethane;pyrrolidine |
| SMILES | C1CCNC1.CC(=O)NC(C)c1ccc(O)cc1.COC |
| InChI | InChI=1S/C10H13NO2.C4H9N.C2H6O/c1-7(11-8(2)12)9-3-5-10(13)6-4-9;1-2-4-5-3-1;1-3-2/h3-7,13H,1-2H3,(H,11,12);5H,1-4H2;1-2H3 |
| InChIKey | KXNUPQYZPZBXQV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |