C24H33FN2O4 — CID 144603208
1-[2-fluoro-4-(3-methoxypropoxy)phenyl]pyrrolidine;N-[1-(4-hydroxyphenyl)ethyl]acetamide (PubChem CID 144603208) has the molecular formula C24H33FN2O4 and a molecular weight of 432.54 g/mol. Its IUPAC name is 1-[2-fluoro-4-(3-methoxypropoxy)phenyl]pyrrolidine;N-[1-(4-hydroxyphenyl)ethyl]acetamide.
| Compound Name | 1-[2-fluoro-4-(3-methoxypropoxy)phenyl]pyrrolidine;N-[1-(4-hydroxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 144603208 |
| Molecular Formula | C24H33FN2O4 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 1-[2-fluoro-4-(3-methoxypropoxy)phenyl]pyrrolidine;N-[1-(4-hydroxyphenyl)ethyl]acetamide |
| SMILES | CC(=O)NC(C)c1ccc(O)cc1.COCCCOc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C14H20FNO2.C10H13NO2/c1-17-9-4-10-18-12-5-6-14(13(15)11-12)16-7-2-3-8-16;1-7(11-8(2)12)9-3-5-10(13)6-4-9/h5-6,11H,2-4,7-10H2,1H3;3-7,13H,1-2H3,(H,11,12) |
| InChIKey | DDLGIWGAORFMAX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|