C18H28O3 — CID 144605307
ethane;(4Z)-5-methoxy-2-methyl-7-phenylmethoxyhepta-2,4-dien-3-ol (PubChem CID 144605307) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is ethane;(4Z)-5-methoxy-2-methyl-7-phenylmethoxyhepta-2,4-dien-3-ol.
| Compound Name | ethane;(4Z)-5-methoxy-2-methyl-7-phenylmethoxyhepta-2,4-dien-3-ol |
|---|---|
| PubChem CID | 144605307 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | ethane;(4Z)-5-methoxy-2-methyl-7-phenylmethoxyhepta-2,4-dien-3-ol |
| SMILES | CC.CO/C(=C\C(O)=C(C)C)CCOCc1ccccc1 |
| InChI | InChI=1S/C16H22O3.C2H6/c1-13(2)16(17)11-15(18-3)9-10-19-12-14-7-5-4-6-8-14;1-2/h4-8,11,17H,9-10,12H2,1-3H3;1-2H3/b15-11-; |
| InChIKey | GYWZLDIOMIAIBJ-PNCOJPCNSA-N |
| XLogP | 5.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|