C16H22O3 — CID 144605308
(4Z)-5-methoxy-2-methyl-7-phenylmethoxyhepta-2,4-dien-3-ol (PubChem CID 144605308) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4Z)-5-methoxy-2-methyl-7-phenylmethoxyhepta-2,4-dien-3-ol.
| Compound Name | (4Z)-5-methoxy-2-methyl-7-phenylmethoxyhepta-2,4-dien-3-ol |
|---|---|
| PubChem CID | 144605308 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (4Z)-5-methoxy-2-methyl-7-phenylmethoxyhepta-2,4-dien-3-ol |
| SMILES | CO/C(=C\C(O)=C(C)C)CCOCc1ccccc1 |
| InChI | InChI=1S/C16H22O3/c1-13(2)16(17)11-15(18-3)9-10-19-12-14-7-5-4-6-8-14/h4-8,11,17H,9-10,12H2,1-3H3/b15-11- |
| InChIKey | SKKNCSXABSUCMJ-PTNGSMBKSA-N |
| XLogP | 3.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|