C9H14BN3O2S — CID 144606787
ethane;[1-methyl-3-(1,3-thiazol-2-yl)pyrazol-5-yl]boronic acid (PubChem CID 144606787) has the molecular formula C9H14BN3O2S and a molecular weight of 239.11 g/mol. Its IUPAC name is ethane;[1-methyl-3-(1,3-thiazol-2-yl)pyrazol-5-yl]boronic acid.
| Compound Name | ethane;[1-methyl-3-(1,3-thiazol-2-yl)pyrazol-5-yl]boronic acid |
|---|---|
| PubChem CID | 144606787 |
| Molecular Formula | C9H14BN3O2S |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | ethane;[1-methyl-3-(1,3-thiazol-2-yl)pyrazol-5-yl]boronic acid |
| SMILES | CC.Cn1nc(-c2nccs2)cc1B(O)O |
| InChI | InChI=1S/C7H8BN3O2S.C2H6/c1-11-6(8(12)13)4-5(10-11)7-9-2-3-14-7;1-2/h2-4,12-13H,1H3;1-2H3 |
| InChIKey | UWHGCECZHOWMEH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|