C42H50O10 — CID 144606931
1-(5-hexyl-2,4-dihydroxyphenyl)-2-phenoxyethanone;methyl 4-[2-(5-hexyl-2,4-dihydroxyphenyl)-2-oxoethoxy]benzoate (PubChem CID 144606931) has the molecular formula C42H50O10 and a molecular weight of 714.85 g/mol. Its IUPAC name is 1-(5-hexyl-2,4-dihydroxyphenyl)-2-phenoxyethanone;methyl 4-[2-(5-hexyl-2,4-dihydroxyphenyl)-2-oxoethoxy]benzoate.
| Compound Name | 1-(5-hexyl-2,4-dihydroxyphenyl)-2-phenoxyethanone;methyl 4-[2-(5-hexyl-2,4-dihydroxyphenyl)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 144606931 |
| Molecular Formula | C42H50O10 |
| Molecular Weight | 714.85 g/mol |
| Exact Mass | 714.34 |
| IUPAC Name | 1-(5-hexyl-2,4-dihydroxyphenyl)-2-phenoxyethanone;methyl 4-[2-(5-hexyl-2,4-dihydroxyphenyl)-2-oxoethoxy]benzoate |
| SMILES | CCCCCCc1cc(C(=O)COc2ccc(C(=O)OC)cc2)c(O)cc1O.CCCCCCc1cc(C(=O)COc2ccccc2)c(O)cc1O |
| InChI | InChI=1S/C22H26O6.C20H24O4/c1-3-4-5-6-7-16-12-18(20(24)13-19(16)23)21(25)14-28-17-10-8-15(9-11-17)22(26)27-2;1-2-3-4-6-9-15-12-17(19(22)13-18(15)21)20(23)14-24-16-10-7-5-8-11-16/h8-13,23-24H,3-7,14H2,1-2H3;5,7-8,10-13,21-22H,2-4,6,9,14H2,1H3 |
| InChIKey | SXRWJZCZTUGALI-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.85 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|