C18H20O4 — CID 886154
1-(5-ethyl-2,4-dihydroxyphenyl)-2-(4-ethylphenoxy)ethanone (PubChem CID 886154) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-(5-ethyl-2,4-dihydroxyphenyl)-2-(4-ethylphenoxy)ethanone.
| Compound Name | 1-(5-ethyl-2,4-dihydroxyphenyl)-2-(4-ethylphenoxy)ethanone |
|---|---|
| PubChem CID | 886154 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-(5-ethyl-2,4-dihydroxyphenyl)-2-(4-ethylphenoxy)ethanone |
| SMILES | CCc1ccc(OCC(=O)c2cc(CC)c(O)cc2O)cc1 |
| InChI | InChI=1S/C18H20O4/c1-3-12-5-7-14(8-6-12)22-11-18(21)15-9-13(4-2)16(19)10-17(15)20/h5-10,19-20H,3-4,11H2,1-2H3 |
| InChIKey | OOYFTBXWTNWMBR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |