C16H14F2O4 — CID 118401844
2-(3,5-difluorophenoxy)-1-(5-ethyl-2,4-dihydroxyphenyl)ethanone (PubChem CID 118401844) has the molecular formula C16H14F2O4 and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-(3,5-difluorophenoxy)-1-(5-ethyl-2,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-(3,5-difluorophenoxy)-1-(5-ethyl-2,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 118401844 |
| Molecular Formula | C16H14F2O4 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(3,5-difluorophenoxy)-1-(5-ethyl-2,4-dihydroxyphenyl)ethanone |
| SMILES | CCc1cc(C(=O)COc2cc(F)cc(F)c2)c(O)cc1O |
| InChI | InChI=1S/C16H14F2O4/c1-2-9-3-13(15(20)7-14(9)19)16(21)8-22-12-5-10(17)4-11(18)6-12/h3-7,19-20H,2,8H2,1H3 |
| InChIKey | UCLJKDDSZVZOTJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |