C16H14N2O4S — CID 144610134
N-buta-1,3-dien-2-yl-3-nitro-4-phenoxybenzenesulfinamide (PubChem CID 144610134) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-3-nitro-4-phenoxybenzenesulfinamide.
| Compound Name | N-buta-1,3-dien-2-yl-3-nitro-4-phenoxybenzenesulfinamide |
|---|---|
| PubChem CID | 144610134 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-buta-1,3-dien-2-yl-3-nitro-4-phenoxybenzenesulfinamide |
| SMILES | C=CC(=C)NS(=O)c1ccc(Oc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14N2O4S/c1-3-12(2)17-23(21)14-9-10-16(15(11-14)18(19)20)22-13-7-5-4-6-8-13/h3-11,17H,1-2H2 |
| InChIKey | CCASTDXYGJKODJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|