C18H18ClN5S2 — CID 144610258
(5S)-5-[3-chloro-5-(5-phenyl-1H-imidazol-2-yl)thiophen-2-yl]-2,5-dimethyl-6H-1,2,4-thiadiazin-3-amine (PubChem CID 144610258) has the molecular formula C18H18ClN5S2 and a molecular weight of 403.96 g/mol. Its IUPAC name is (5S)-5-[3-chloro-5-(5-phenyl-1H-imidazol-2-yl)thiophen-2-yl]-2,5-dimethyl-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-5-(5-phenyl-1H-imidazol-2-yl)thiophen-2-yl]-2,5-dimethyl-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 144610258 |
| Molecular Formula | C18H18ClN5S2 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | (5S)-5-[3-chloro-5-(5-phenyl-1H-imidazol-2-yl)thiophen-2-yl]-2,5-dimethyl-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1SC[C@@](C)(c2sc(-c3ncc(-c4ccccc4)[nH]3)cc2Cl)N=C1N |
| InChI | InChI=1S/C18H18ClN5S2/c1-18(10-25-24(2)17(20)23-18)15-12(19)8-14(26-15)16-21-9-13(22-16)11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H2,20,23)(H,21,22)/t18-/m0/s1 |
| InChIKey | RYCWKTRULMLZAI-SFHVURJKSA-N |
| XLogP | 4.58 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|