C19H21ClN6O2S2 — CID 160609720
(5S)-5-[3-chloro-5-[5-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-1H-pyrrol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 160609720) has the molecular formula C19H21ClN6O2S2 and a molecular weight of 465.00 g/mol. Its IUPAC name is (5S)-5-[3-chloro-5-[5-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-1H-pyrrol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-5-[5-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-1H-pyrrol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 160609720 |
| Molecular Formula | C19H21ClN6O2S2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | (5S)-5-[3-chloro-5-[5-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-1H-pyrrol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3ccc(-c4nnc(C5CC5)o4)[nH]3)cc2Cl)N=C(N)N1C |
| InChI | InChI=1S/C19H21ClN6O2S2/c1-19(9-30(3,27)26(2)18(21)23-19)15-11(20)8-14(29-15)12-6-7-13(22-12)17-25-24-16(28-17)10-4-5-10/h6-8,10,22H,3-5,9H2,1-2H3,(H2,21,23)/t19-,30?/m0/s1 |
| InChIKey | ZDFWCOKNUVBNEC-QUZMYUOTSA-N |
| XLogP | 3.43 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|