C19H18ClF2N5O3S2 — CID 158456500
(5S)-5-[3-chloro-5-[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 158456500) has the molecular formula C19H18ClF2N5O3S2 and a molecular weight of 501.97 g/mol. Its IUPAC name is (5S)-5-[3-chloro-5-[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-5-[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 158456500 |
| Molecular Formula | C19H18ClF2N5O3S2 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | (5S)-5-[3-chloro-5-[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3nnc(-c4ccc(OC(F)F)cc4)o3)cc2Cl)N=C(N)N1C |
| InChI | InChI=1S/C19H18ClF2N5O3S2/c1-19(9-32(3,28)27(2)18(23)24-19)14-12(20)8-13(31-14)16-26-25-15(30-16)10-4-6-11(7-5-10)29-17(21)22/h4-8,17H,3,9H2,1-2H3,(H2,23,24)/t19-,32?/m0/s1 |
| InChIKey | ZKXQDJLRODEQGF-LSJBEEMESA-N |
| XLogP | 3.83 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|