C17H17FN6O3S — CID 158419902
(5R)-5-[2-fluoro-5-[5-(1,3-oxazol-5-yl)-1,3,4-oxadiazol-2-yl]phenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 158419902) has the molecular formula C17H17FN6O3S and a molecular weight of 404.43 g/mol. Its IUPAC name is (5R)-5-[2-fluoro-5-[5-(1,3-oxazol-5-yl)-1,3,4-oxadiazol-2-yl]phenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[2-fluoro-5-[5-(1,3-oxazol-5-yl)-1,3,4-oxadiazol-2-yl]phenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 158419902 |
| Molecular Formula | C17H17FN6O3S |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (5R)-5-[2-fluoro-5-[5-(1,3-oxazol-5-yl)-1,3,4-oxadiazol-2-yl]phenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2cc(-c3nnc(-c4cnco4)o3)ccc2F)N=C(N)N1C |
| InChI | InChI=1S/C17H17FN6O3S/c1-17(8-28(3,25)24(2)16(19)21-17)11-6-10(4-5-12(11)18)14-22-23-15(27-14)13-7-20-9-26-13/h4-7,9H,3,8H2,1-2H3,(H2,19,21)/t17-,28?/m0/s1 |
| InChIKey | FLUBHBKDSAQDGG-FQSKIORSSA-N |
| XLogP | 1.64 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|