C16H18ClN7O2S2 — CID 158489586
(5S)-5-[3-chloro-5-[5-(1-methylpyrazol-4-yl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 158489586) has the molecular formula C16H18ClN7O2S2 and a molecular weight of 439.95 g/mol. Its IUPAC name is (5S)-5-[3-chloro-5-[5-(1-methylpyrazol-4-yl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-5-[5-(1-methylpyrazol-4-yl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 158489586 |
| Molecular Formula | C16H18ClN7O2S2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (5S)-5-[3-chloro-5-[5-(1-methylpyrazol-4-yl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3nnc(-c4cnn(C)c4)o3)cc2Cl)N=C(N)N1C |
| InChI | InChI=1S/C16H18ClN7O2S2/c1-16(8-28(4,25)24(3)15(18)20-16)12-10(17)5-11(27-12)14-22-21-13(26-14)9-6-19-23(2)7-9/h5-7H,4,8H2,1-3H3,(H2,18,20)/t16-,28?/m0/s1 |
| InChIKey | NVSOSYIZMBLGIA-WCZHWJSASA-N |
| XLogP | 1.96 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|