C21H20ClN7O2S2 — CID 159847116
(5S)-5-[3-chloro-5-[5-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 159847116) has the molecular formula C21H20ClN7O2S2 and a molecular weight of 502.03 g/mol. Its IUPAC name is (5S)-5-[3-chloro-5-[5-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-5-[5-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 159847116 |
| Molecular Formula | C21H20ClN7O2S2 |
| Molecular Weight | 502.03 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | (5S)-5-[3-chloro-5-[5-(4-pyrazol-1-ylphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3nnc(-c4ccc(-n5cccn5)cc4)o3)cc2Cl)N=C(N)N1C |
| InChI | InChI=1S/C21H20ClN7O2S2/c1-21(12-33(3,30)28(2)20(23)25-21)17-15(22)11-16(32-17)19-27-26-18(31-19)13-5-7-14(8-6-13)29-10-4-9-24-29/h4-11H,3,12H2,1-2H3,(H2,23,25)/t21-,33?/m0/s1 |
| InChIKey | RZHWCNWIPJUOSD-KEDGCLKXSA-N |
| XLogP | 3.41 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.03 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|