C21H22ClN5O2S2 — CID 162244481
(5S)-5-[3-chloro-5-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 162244481) has the molecular formula C21H22ClN5O2S2 and a molecular weight of 476.03 g/mol. Its IUPAC name is (5S)-5-[3-chloro-5-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-5-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 162244481 |
| Molecular Formula | C21H22ClN5O2S2 |
| Molecular Weight | 476.03 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | (5S)-5-[3-chloro-5-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3cccc(-c4nnc(C5CC5)o4)c3)cc2Cl)N=C(N)N1C |
| InChI | InChI=1S/C21H22ClN5O2S2/c1-21(11-31(3,28)27(2)20(23)24-21)17-15(22)10-16(30-17)13-5-4-6-14(9-13)19-26-25-18(29-19)12-7-8-12/h4-6,9-10,12H,3,7-8,11H2,1-2H3,(H2,23,24)/t21-,31?/m0/s1 |
| InChIKey | ZXDLYAPXFYKGMX-FEAGIOCNSA-N |
| XLogP | 4.10 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.03 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|