C17H18N4OS2 — CID 161395318
3-[5-[(5S)-3-amino-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-5-yl]thiophen-2-yl]benzonitrile (PubChem CID 161395318) has the molecular formula C17H18N4OS2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[5-[(5S)-3-amino-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-5-yl]thiophen-2-yl]benzonitrile.
| Compound Name | 3-[5-[(5S)-3-amino-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-5-yl]thiophen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 161395318 |
| Molecular Formula | C17H18N4OS2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 3-[5-[(5S)-3-amino-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-5-yl]thiophen-2-yl]benzonitrile |
| SMILES | C=S1(=O)C[C@@](C)(c2ccc(-c3cccc(C#N)c3)s2)N=C(N)N1C |
| InChI | InChI=1S/C17H18N4OS2/c1-17(11-24(3,22)21(2)16(19)20-17)15-8-7-14(23-15)13-6-4-5-12(9-13)10-18/h4-9H,3,11H2,1-2H3,(H2,19,20)/t17-,24?/m0/s1 |
| InChIKey | PEZKMLPDCCYVLT-KEJDIYNNSA-N |
| XLogP | 2.39 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|