C17H19ClN4OS — CID 162172789
(5R)-5-[3-(5-chloro-3-pyridinyl)phenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 162172789) has the molecular formula C17H19ClN4OS and a molecular weight of 362.89 g/mol. Its IUPAC name is (5R)-5-[3-(5-chloro-3-pyridinyl)phenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[3-(5-chloro-3-pyridinyl)phenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 162172789 |
| Molecular Formula | C17H19ClN4OS |
| Molecular Weight | 362.89 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (5R)-5-[3-(5-chloro-3-pyridinyl)phenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2cccc(-c3cncc(Cl)c3)c2)N=C(N)N1C |
| InChI | InChI=1S/C17H19ClN4OS/c1-17(11-24(3,23)22(2)16(19)21-17)14-6-4-5-12(7-14)13-8-15(18)10-20-9-13/h4-10H,3,11H2,1-2H3,(H2,19,21)/t17-,24?/m0/s1 |
| InChIKey | HVARGRJKVKFKAE-KEJDIYNNSA-N |
| XLogP | 2.51 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|