C17H18BrN5OS2 — CID 161327116
(5S)-5-[5-[5-(2-aminoethynyl)-3-pyridinyl]-3-bromothiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 161327116) has the molecular formula C17H18BrN5OS2 and a molecular weight of 452.40 g/mol. Its IUPAC name is (5S)-5-[5-[5-(2-aminoethynyl)-3-pyridinyl]-3-bromothiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[5-[5-(2-aminoethynyl)-3-pyridinyl]-3-bromothiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 161327116 |
| Molecular Formula | C17H18BrN5OS2 |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | (5S)-5-[5-[5-(2-aminoethynyl)-3-pyridinyl]-3-bromothiophen-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3cncc(C#CN)c3)cc2Br)N=C(N)N1C |
| InChI | InChI=1S/C17H18BrN5OS2/c1-17(10-26(3,24)23(2)16(20)22-17)15-13(18)7-14(25-15)12-6-11(4-5-19)8-21-9-12/h6-9H,3,10,19H2,1-2H3,(H2,20,22)/t17-,26?/m0/s1 |
| InChIKey | YKGNZTPDGGGXCI-WFFHQLTOSA-N |
| XLogP | 1.95 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|