C20H22ClN3OS2 — CID 158111900
(3S)-3-[3-chloro-5-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine (PubChem CID 158111900) has the molecular formula C20H22ClN3OS2 and a molecular weight of 420.00 g/mol. Its IUPAC name is (3S)-3-[3-chloro-5-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3S)-3-[3-chloro-5-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 158111900 |
| Molecular Formula | C20H22ClN3OS2 |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (3S)-3-[3-chloro-5-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3cncc(C#CC)c3)cc2Cl)N=C(N)C1(C)C |
| InChI | InChI=1S/C20H22ClN3OS2/c1-6-7-13-8-14(11-23-10-13)16-9-15(21)17(26-16)20(4)12-27(5,25)19(2,3)18(22)24-20/h8-11H,5,12H2,1-4H3,(H2,22,24)/t20-,27?/m0/s1 |
| InChIKey | PQQQIGUUBSTHOU-SVQMELKDSA-N |
| XLogP | 3.92 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|