C19H20FN5O2S2 — CID 162225843
(3S)-3-[3-fluoro-5-[5-(1,3,4-oxadiazol-2-yl)-3-pyridinyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine (PubChem CID 162225843) has the molecular formula C19H20FN5O2S2 and a molecular weight of 433.53 g/mol. Its IUPAC name is (3S)-3-[3-fluoro-5-[5-(1,3,4-oxadiazol-2-yl)-3-pyridinyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3S)-3-[3-fluoro-5-[5-(1,3,4-oxadiazol-2-yl)-3-pyridinyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 162225843 |
| Molecular Formula | C19H20FN5O2S2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (3S)-3-[3-fluoro-5-[5-(1,3,4-oxadiazol-2-yl)-3-pyridinyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3cncc(-c4nnco4)c3)cc2F)N=C(N)C1(C)C |
| InChI | InChI=1S/C19H20FN5O2S2/c1-18(2)17(21)24-19(3,9-29(18,4)26)15-13(20)6-14(28-15)11-5-12(8-22-7-11)16-25-23-10-27-16/h5-8,10H,4,9H2,1-3H3,(H2,21,24)/t19-,29?/m0/s1 |
| InChIKey | VFGZMUQYTDEUJV-KCHZNAQISA-N |
| XLogP | 3.08 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|