C19H19ClN4O3S2 — CID 123347257
4a-[3-chloro-5-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-2-methyl-1,1-dioxo-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-3-amine (PubChem CID 123347257) has the molecular formula C19H19ClN4O3S2 and a molecular weight of 450.97 g/mol. Its IUPAC name is 4a-[3-chloro-5-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-2-methyl-1,1-dioxo-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-3-amine.
| Compound Name | 4a-[3-chloro-5-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-2-methyl-1,1-dioxo-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-3-amine |
|---|---|
| PubChem CID | 123347257 |
| Molecular Formula | C19H19ClN4O3S2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 4a-[3-chloro-5-(5-prop-1-ynyl-3-pyridinyl)thiophen-2-yl]-2-methyl-1,1-dioxo-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-3-amine |
| SMILES | CC#Cc1cncc(-c2cc(Cl)c(C34CCCOC3S(=O)(=O)N(C)C(N)=N4)s2)c1 |
| InChI | InChI=1S/C19H19ClN4O3S2/c1-3-5-12-8-13(11-22-10-12)15-9-14(20)16(28-15)19-6-4-7-27-17(19)29(25,26)24(2)18(21)23-19/h8-11,17H,4,6-7H2,1-2H3,(H2,21,23) |
| InChIKey | BITBGYVCMBJVEL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|