C15H16ClN5OS2 — CID 130394785
4a-(3-chloro-5-pyrimidin-5-ylthiophen-2-yl)-2-methyl-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-3-amine (PubChem CID 130394785) has the molecular formula C15H16ClN5OS2 and a molecular weight of 381.91 g/mol. Its IUPAC name is 4a-(3-chloro-5-pyrimidin-5-ylthiophen-2-yl)-2-methyl-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-3-amine.
| Compound Name | 4a-(3-chloro-5-pyrimidin-5-ylthiophen-2-yl)-2-methyl-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-3-amine |
|---|---|
| PubChem CID | 130394785 |
| Molecular Formula | C15H16ClN5OS2 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 4a-(3-chloro-5-pyrimidin-5-ylthiophen-2-yl)-2-methyl-5,6,7,8a-tetrahydropyrano[3,2-e][1,2,4]thiadiazin-3-amine |
| SMILES | CN1SC2OCCCC2(c2sc(-c3cncnc3)cc2Cl)N=C1N |
| InChI | InChI=1S/C15H16ClN5OS2/c1-21-14(17)20-15(3-2-4-22-13(15)24-21)12-10(16)5-11(23-12)9-6-18-8-19-7-9/h5-8,13H,2-4H2,1H3,(H2,17,20) |
| InChIKey | AJPZXJLBZSFDHL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|