C20H19ClFN5O2S — CID 158419904
(5R)-5-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 158419904) has the molecular formula C20H19ClFN5O2S and a molecular weight of 447.92 g/mol. Its IUPAC name is (5R)-5-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 158419904 |
| Molecular Formula | C20H19ClFN5O2S |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (5R)-5-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2cc(-c3nnc(-c4ccc(Cl)cc4)o3)ccc2F)N=C(N)N1C |
| InChI | InChI=1S/C20H19ClFN5O2S/c1-20(11-30(3,28)27(2)19(23)24-20)15-10-13(6-9-16(15)22)18-26-25-17(29-18)12-4-7-14(21)8-5-12/h4-10H,3,11H2,1-2H3,(H2,23,24)/t20-,30?/m0/s1 |
| InChIKey | SUPKZMJFTOOLRG-JGZNSJETSA-N |
| XLogP | 3.30 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|