C20H23ClN6 — CID 1446129
1-[(1-benzyltetrazol-5-yl)methyl]-4-(5-chloro-2-methylphenyl)piperazine (PubChem CID 1446129) has the molecular formula C20H23ClN6 and a molecular weight of 382.90 g/mol. Its IUPAC name is 1-[(1-benzyltetrazol-5-yl)methyl]-4-(5-chloro-2-methylphenyl)piperazine.
| Compound Name | 1-[(1-benzyltetrazol-5-yl)methyl]-4-(5-chloro-2-methylphenyl)piperazine |
|---|---|
| PubChem CID | 1446129 |
| Molecular Formula | C20H23ClN6 |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[(1-benzyltetrazol-5-yl)methyl]-4-(5-chloro-2-methylphenyl)piperazine |
| SMILES | Cc1ccc(Cl)cc1N1CCN(Cc2nnnn2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23ClN6/c1-16-7-8-18(21)13-19(16)26-11-9-25(10-12-26)15-20-22-23-24-27(20)14-17-5-3-2-4-6-17/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | BGXMPXZMOAEGEI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |