C11H14FNO4 — CID 144617753
ethane;2-(3-fluoro-4,5-dihydroxyphenyl)-N-methyl-2-oxoacetamide (PubChem CID 144617753) has the molecular formula C11H14FNO4 and a molecular weight of 243.23 g/mol. Its IUPAC name is ethane;2-(3-fluoro-4,5-dihydroxyphenyl)-N-methyl-2-oxoacetamide.
| Compound Name | ethane;2-(3-fluoro-4,5-dihydroxyphenyl)-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 144617753 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | ethane;2-(3-fluoro-4,5-dihydroxyphenyl)-N-methyl-2-oxoacetamide |
| SMILES | CC.CNC(=O)C(=O)c1cc(O)c(O)c(F)c1 |
| InChI | InChI=1S/C9H8FNO4.C2H6/c1-11-9(15)7(13)4-2-5(10)8(14)6(12)3-4;1-2/h2-3,12,14H,1H3,(H,11,15);1-2H3 |
| InChIKey | HCDMHDNIHBWZPE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|