C9H8FNO3 — CID 136594389
1-(3-fluoro-4,5-dihydroxyphenyl)-1-iminopropan-2-one (PubChem CID 136594389) has the molecular formula C9H8FNO3 and a molecular weight of 197.16 g/mol. Its IUPAC name is 1-(3-fluoro-4,5-dihydroxyphenyl)-1-iminopropan-2-one.
| Compound Name | 1-(3-fluoro-4,5-dihydroxyphenyl)-1-iminopropan-2-one |
|---|---|
| PubChem CID | 136594389 |
| Molecular Formula | C9H8FNO3 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 1-(3-fluoro-4,5-dihydroxyphenyl)-1-iminopropan-2-one |
| SMILES | [H]/N=C(\C(C)=O)c1cc(O)c(O)c(F)c1 |
| InChI | InChI=1S/C9H8FNO3/c1-4(12)8(11)5-2-6(10)9(14)7(13)3-5/h2-3,11,13-14H,1H3/b11-8+ |
| InChIKey | XTFZAIPGCVMFDF-DHZHZOJOSA-N |
| XLogP | 1.19 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|